C26H24N2O2S — CID 135295627
N-(3-carbazol-9-yl-2-hydroxypropyl)-N-naphthalen-1-ylmethanesulfinamide (PubChem CID 135295627) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-(3-carbazol-9-yl-2-hydroxypropyl)-N-naphthalen-1-ylmethanesulfinamide.
| Compound Name | N-(3-carbazol-9-yl-2-hydroxypropyl)-N-naphthalen-1-ylmethanesulfinamide |
|---|---|
| PubChem CID | 135295627 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-(3-carbazol-9-yl-2-hydroxypropyl)-N-naphthalen-1-ylmethanesulfinamide |
| SMILES | CS(=O)N(CC(O)Cn1c2ccccc2c2ccccc21)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H24N2O2S/c1-31(30)28(26-16-8-10-19-9-2-3-11-21(19)26)18-20(29)17-27-24-14-6-4-12-22(24)23-13-5-7-15-25(23)27/h2-16,20,29H,17-18H2,1H3 |
| InChIKey | NXEXGQXQTZAQRP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |