About 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole
3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole (PubChem CID 135296140) has the molecular formula C8H13N3S2
and a molecular weight of 215.35 g/mol. Its IUPAC name is 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole |
| PubChem CID | 135296140 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole |
| SMILES | CC(C)N1Cc2[nH]nc(SS)c2C1 |
| InChI | InChI=1S/C8H13N3S2/c1-5(2)11-3-6-7(4-11)9-10-8(6)13-12/h5,12H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | CIIMHXZYISYALU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The IUPAC name of 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole (CID 135296140) is 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole.
What is the SMILES notation for 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The canonical SMILES for 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole is CC(C)N1Cc2[nH]nc(SS)c2C1.
What is the InChIKey of 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
The InChIKey is CIIMHXZYISYALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S2/c1-5(2)11-3-6-7(4-11)9-10-8(6)13-12/h5,12H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole?
3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole has a molecular weight of 215.35 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(disulfanyl)-5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole is sourced from PubChem (CID 135296140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).