About N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide
N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide (PubChem CID 135296365) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide |
| PubChem CID | 135296365 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide |
| SMILES | CC(C)=C(C)C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H16N2O3/c1-6(2)7(3)10(15)12-8-4-5-9(14)13-11(8)16/h8H,4-5H2,1-3H3,(H,12,15)(H,13,14,16) |
| InChIKey | HSXMACSVRILAAL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide?
The IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide (CID 135296365) is N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide.
What is the SMILES notation for N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide?
The canonical SMILES for N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide is CC(C)=C(C)C(=O)NC1CCC(=O)NC1=O.
What is the InChIKey of N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide?
The InChIKey is HSXMACSVRILAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-6(2)7(3)10(15)12-8-4-5-9(14)13-11(8)16/h8H,4-5H2,1-3H3,(H,12,15)(H,13,14,16).
What are the key properties of N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide?
N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide has a molecular weight of 224.26 g/mol, XLogP of 0.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dioxopiperidin-3-yl)-2,3-dimethylbut-2-enamide is sourced from PubChem (CID 135296365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).