C24H32F3N5OS — CID 135297052
(3aR,6aR)-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 135297052) has the molecular formula C24H32F3N5OS and a molecular weight of 495.62 g/mol. Its IUPAC name is (3aR,6aR)-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 135297052 |
| Molecular Formula | C24H32F3N5OS |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (3aR,6aR)-5-[3-[[4-methyl-5-(oxan-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cn1c(SCCCN2C[C@H]3CCN(c4ccc(C(F)(F)F)cc4)[C@H]3C2)nnc1C1CCOCC1 |
| InChI | InChI=1S/C24H32F3N5OS/c1-30-22(17-8-12-33-13-9-17)28-29-23(30)34-14-2-10-31-15-18-7-11-32(21(18)16-31)20-5-3-19(4-6-20)24(25,26)27/h3-6,17-18,21H,2,7-16H2,1H3/t18-,21+/m1/s1 |
| InChIKey | CAVOXTSDVAGWFI-NQIIRXRSSA-N |
| XLogP | 4.42 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|