C20H7Cl4I3O3 — CID 135298546
6-hydroxy-2,4,5-triiodo-7-methyl-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one (PubChem CID 135298546) has the molecular formula C20H7Cl4I3O3 and a molecular weight of 817.80 g/mol. Its IUPAC name is 6-hydroxy-2,4,5-triiodo-7-methyl-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one.
| Compound Name | 6-hydroxy-2,4,5-triiodo-7-methyl-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one |
|---|---|
| PubChem CID | 135298546 |
| Molecular Formula | C20H7Cl4I3O3 |
| Molecular Weight | 817.80 g/mol |
| Exact Mass | 815.63 |
| IUPAC Name | 6-hydroxy-2,4,5-triiodo-7-methyl-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one |
| SMILES | Cc1cc2c(-c3cc(Cl)c(Cl)c(Cl)c3Cl)c3cc(I)c(=O)c(I)c-3oc2c(I)c1O |
| InChI | InChI=1S/C20H7Cl4I3O3/c1-5-2-7-11(6-3-9(21)13(23)14(24)12(6)22)8-4-10(25)18(29)16(27)20(8)30-19(7)15(26)17(5)28/h2-4,28H,1H3 |
| InChIKey | MLTFQFORUUBAHA-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.80 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|