C17H19FN2O4S — CID 135298630
3-butoxy-N'-(2-fluorophenyl)sulfonylbenzohydrazide (PubChem CID 135298630) has the molecular formula C17H19FN2O4S and a molecular weight of 366.41 g/mol. Its IUPAC name is 3-butoxy-N'-(2-fluorophenyl)sulfonylbenzohydrazide.
| Compound Name | 3-butoxy-N'-(2-fluorophenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 135298630 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-butoxy-N'-(2-fluorophenyl)sulfonylbenzohydrazide |
| SMILES | CCCCOc1cccc(C(=O)NNS(=O)(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C17H19FN2O4S/c1-2-3-11-24-14-8-6-7-13(12-14)17(21)19-20-25(22,23)16-10-5-4-9-15(16)18/h4-10,12,20H,2-3,11H2,1H3,(H,19,21) |
| InChIKey | QGOBJVCKVWHRRO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|