About (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate
(4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate (PubChem CID 135299822) has the molecular formula C16H22O4S
and a molecular weight of 310.41 g/mol. Its IUPAC name is (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate.
Molecular Properties
| Compound Name | (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate |
| PubChem CID | 135299822 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate |
| SMILES | CC(=O)OC1C(C)OC(Sc2ccccc2)CCC1(C)O |
| InChI | InChI=1S/C16H22O4S/c1-11-15(20-12(2)17)16(3,18)10-9-14(19-11)21-13-7-5-4-6-8-13/h4-8,11,14-15,18H,9-10H2,1-3H3 |
| InChIKey | BYZPVNOQDQIZCA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate?
The IUPAC name of (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate (CID 135299822) is (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate.
What is the SMILES notation for (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate?
The canonical SMILES for (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate is CC(=O)OC1C(C)OC(Sc2ccccc2)CCC1(C)O.
What is the InChIKey of (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate?
The InChIKey is BYZPVNOQDQIZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4S/c1-11-15(20-12(2)17)16(3,18)10-9-14(19-11)21-13-7-5-4-6-8-13/h4-8,11,14-15,18H,9-10H2,1-3H3.
What are the key properties of (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate?
(4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate has a molecular weight of 310.41 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2,4-dimethyl-7-phenylsulfanyloxepan-3-yl) acetate is sourced from PubChem (CID 135299822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).