C27H27ClN8OS — CID 135299983
2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[2-(methylamino)ethyl]acetamide (PubChem CID 135299983) has the molecular formula C27H27ClN8OS and a molecular weight of 547.09 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[2-(methylamino)ethyl]acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[2-(methylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 135299983 |
| Molecular Formula | C27H27ClN8OS |
| Molecular Weight | 547.09 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCNC(=O)C[C@@H]1N=C(c2ccc(Cl)cc2)c2c(sc(C#Cc3cncn3C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C27H27ClN8OS/c1-16-22(10-9-20-14-30-15-35(20)4)38-27-24(16)25(18-5-7-19(28)8-6-18)32-21(13-23(37)31-12-11-29-3)26-34-33-17(2)36(26)27/h5-8,14-15,21,29H,11-13H2,1-4H3,(H,31,37)/t21-/m0/s1 |
| InChIKey | FEMBGWPKTWRQPE-NRFANRHFSA-N |
| XLogP | 3.35 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.09 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|