C25H20ClN5O2S — CID 135300007
2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-11-oxa-3-thia-8,12-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,12-pentaen-9-yl]acetamide (PubChem CID 135300007) has the molecular formula C25H20ClN5O2S and a molecular weight of 489.99 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-11-oxa-3-thia-8,12-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,12-pentaen-9-yl]acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-11-oxa-3-thia-8,12-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,12-pentaen-9-yl]acetamide |
|---|---|
| PubChem CID | 135300007 |
| Molecular Formula | C25H20ClN5O2S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-[2-(3-methylimidazol-4-yl)ethynyl]-11-oxa-3-thia-8,12-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,7,12-pentaen-9-yl]acetamide |
| SMILES | Cc1noc2c1-c1sc(C#Cc3cncn3C)c(C)c1C(c1ccc(Cl)cc1)=N[C@H]2CC(N)=O |
| InChI | InChI=1S/C25H20ClN5O2S/c1-13-19(9-8-17-11-28-12-31(17)3)34-25-21(13)23(15-4-6-16(26)7-5-15)29-18(10-20(27)32)24-22(25)14(2)30-33-24/h4-7,11-12,18H,10H2,1-3H3,(H2,27,32)/t18-/m0/s1 |
| InChIKey | HUHLAXUNESETPX-SFHVURJKSA-N |
| XLogP | 4.57 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|