C29H26ClN7OS — CID 135300056
(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-6-methyl-3-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]-7-(2-pyridin-2-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine (PubChem CID 135300056) has the molecular formula C29H26ClN7OS and a molecular weight of 556.10 g/mol. Its IUPAC name is (3S)-5-(4-chlorophenyl)-1-ethanimidoyl-6-methyl-3-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]-7-(2-pyridin-2-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine.
| Compound Name | (3S)-5-(4-chlorophenyl)-1-ethanimidoyl-6-methyl-3-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]-7-(2-pyridin-2-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135300056 |
| Molecular Formula | C29H26ClN7OS |
| Molecular Weight | 556.10 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | (3S)-5-(4-chlorophenyl)-1-ethanimidoyl-6-methyl-3-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]-7-(2-pyridin-2-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](Cc2nnc(C(C)C)o2)N=C(c2ccc(Cl)cc2)c2c1sc(C#Cc1ccccn1)c2C |
| InChI | InChI=1S/C29H26ClN7OS/c1-16(2)28-36-35-24(38-28)15-22-27(32)37(18(4)31)29-25(26(34-22)19-8-10-20(30)11-9-19)17(3)23(39-29)13-12-21-7-5-6-14-33-21/h5-11,14,16,22,31-32H,15H2,1-4H3/b31-18+,32-27+/t22-/m0/s1 |
| InChIKey | NBOFQHMSIKMKAO-QTRCOYNESA-N |
| XLogP | 6.25 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.10 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|