About 1-buta-1,3-dien-2-yltetrazole
1-buta-1,3-dien-2-yltetrazole (PubChem CID 135300148) has the molecular formula C5H6N4
and a molecular weight of 122.13 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yltetrazole.
Molecular Properties
| Compound Name | 1-buta-1,3-dien-2-yltetrazole |
| PubChem CID | 135300148 |
| Molecular Formula | C5H6N4 |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 1-buta-1,3-dien-2-yltetrazole |
| SMILES | C=CC(=C)n1cnnn1 |
| InChI | InChI=1S/C5H6N4/c1-3-5(2)9-4-6-7-8-9/h3-4H,1-2H2 |
| InChIKey | RNSCEWZSKJOKLE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dien-2-yltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dien-2-yltetrazole?
The IUPAC name of 1-buta-1,3-dien-2-yltetrazole (CID 135300148) is 1-buta-1,3-dien-2-yltetrazole.
What is the SMILES notation for 1-buta-1,3-dien-2-yltetrazole?
The canonical SMILES for 1-buta-1,3-dien-2-yltetrazole is C=CC(=C)n1cnnn1.
What is the InChIKey of 1-buta-1,3-dien-2-yltetrazole?
The InChIKey is RNSCEWZSKJOKLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4/c1-3-5(2)9-4-6-7-8-9/h3-4H,1-2H2.
What are the key properties of 1-buta-1,3-dien-2-yltetrazole?
1-buta-1,3-dien-2-yltetrazole has a molecular weight of 122.13 g/mol, XLogP of 0.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dien-2-yltetrazole is sourced from PubChem (CID 135300148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).