C27H41NO — CID 135300225
N,N-dibutyl-4-[(E)-2-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]ethenyl]-3-methoxyaniline (PubChem CID 135300225) has the molecular formula C27H41NO and a molecular weight of 395.63 g/mol. Its IUPAC name is N,N-dibutyl-4-[(E)-2-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]ethenyl]-3-methoxyaniline.
| Compound Name | N,N-dibutyl-4-[(E)-2-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]ethenyl]-3-methoxyaniline |
|---|---|
| PubChem CID | 135300225 |
| Molecular Formula | C27H41NO |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | N,N-dibutyl-4-[(E)-2-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]ethenyl]-3-methoxyaniline |
| SMILES | C/C=C1/C=C(/C=C/c2ccc(N(CCCC)CCCC)cc2OC)CC(C)(C)C1 |
| InChI | InChI=1S/C27H41NO/c1-7-10-16-28(17-11-8-2)25-15-14-24(26(19-25)29-6)13-12-23-18-22(9-3)20-27(4,5)21-23/h9,12-15,18-19H,7-8,10-11,16-17,20-21H2,1-6H3/b13-12+,22-9- |
| InChIKey | DUXIUKUHCZGPSO-ZCAVQPKMSA-N |
| XLogP | 7.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|