About (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone
(6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone (PubChem CID 135300270) has the molecular formula C18H18N4O
and a molecular weight of 306.37 g/mol. Its IUPAC name is (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone |
| PubChem CID | 135300270 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc2ncc(-c3ccccc3)cn2n1)N1CCCCC1 |
| InChI | InChI=1S/C18H18N4O/c23-18(21-9-5-2-6-10-21)16-11-17-19-12-15(13-22(17)20-16)14-7-3-1-4-8-14/h1,3-4,7-8,11-13H,2,5-6,9-10H2 |
| InChIKey | FMPLEOQOMDDUKI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone?
The IUPAC name of (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone (CID 135300270) is (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone is O=C(c1cc2ncc(-c3ccccc3)cn2n1)N1CCCCC1.
What is the InChIKey of (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone?
The InChIKey is FMPLEOQOMDDUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O/c23-18(21-9-5-2-6-10-21)16-11-17-19-12-15(13-22(17)20-16)14-7-3-1-4-8-14/h1,3-4,7-8,11-13H,2,5-6,9-10H2.
What are the key properties of (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone?
(6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone has a molecular weight of 306.37 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-phenylpyrazolo[1,5-a]pyrimidin-2-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 135300270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).