C22H22N4OS — CID 135300341
2-butylsulfanyl-5-(4-methoxyphenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 135300341) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-butylsulfanyl-5-(4-methoxyphenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-butylsulfanyl-5-(4-methoxyphenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 135300341 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-butylsulfanyl-5-(4-methoxyphenyl)-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCCCSc1nc2nc(-c3ccc(OC)cc3)cc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C22H22N4OS/c1-3-4-14-28-22-24-21-23-19(16-10-12-18(27-2)13-11-16)15-20(26(21)25-22)17-8-6-5-7-9-17/h5-13,15H,3-4,14H2,1-2H3 |
| InChIKey | VICMHIBXURTXNF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|