C19H30N2O4 — CID 135300370
3-[3-(4-tert-butyl-2,5-dioxopyrrolidin-3-yl)-2,3-dimethylbutan-2-yl]-1-methylpyrrolidine-2,5-dione (PubChem CID 135300370) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-[3-(4-tert-butyl-2,5-dioxopyrrolidin-3-yl)-2,3-dimethylbutan-2-yl]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[3-(4-tert-butyl-2,5-dioxopyrrolidin-3-yl)-2,3-dimethylbutan-2-yl]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 135300370 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3-[3-(4-tert-butyl-2,5-dioxopyrrolidin-3-yl)-2,3-dimethylbutan-2-yl]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(C(C)(C)C(C)(C)C2C(=O)NC(=O)C2C(C)(C)C)C1=O |
| InChI | InChI=1S/C19H30N2O4/c1-17(2,3)12-13(15(24)20-14(12)23)19(6,7)18(4,5)10-9-11(22)21(8)16(10)25/h10,12-13H,9H2,1-8H3,(H,20,23,24) |
| InChIKey | IBERKGDTNQMOFP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|