About piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone
piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone (PubChem CID 135300402) has the molecular formula C17H16N4OS
and a molecular weight of 324.41 g/mol. Its IUPAC name is piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone.
Molecular Properties
| Compound Name | piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone |
| PubChem CID | 135300402 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone |
| SMILES | O=C(c1ccc2ncc(-c3nccs3)nc2c1)N1CCCCC1 |
| InChI | InChI=1S/C17H16N4OS/c22-17(21-7-2-1-3-8-21)12-4-5-13-14(10-12)20-15(11-19-13)16-18-6-9-23-16/h4-6,9-11H,1-3,7-8H2 |
| InChIKey | KGYZEHVIBRFIHL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone?
The IUPAC name of piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone (CID 135300402) is piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone.
What is the SMILES notation for piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone?
The canonical SMILES for piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone is O=C(c1ccc2ncc(-c3nccs3)nc2c1)N1CCCCC1.
What is the InChIKey of piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone?
The InChIKey is KGYZEHVIBRFIHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4OS/c22-17(21-7-2-1-3-8-21)12-4-5-13-14(10-12)20-15(11-19-13)16-18-6-9-23-16/h4-6,9-11H,1-3,7-8H2.
What are the key properties of piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone?
piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone has a molecular weight of 324.41 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-yl-[3-(1,3-thiazol-2-yl)quinoxalin-6-yl]methanone is sourced from PubChem (CID 135300402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).