C13H21NO3 — CID 135300540
[(2E,5Z)-6-methylocta-2,5-dienyl] N-(3-oxopropyl)carbamate (PubChem CID 135300540) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is [(2E,5Z)-6-methylocta-2,5-dienyl] N-(3-oxopropyl)carbamate.
| Compound Name | [(2E,5Z)-6-methylocta-2,5-dienyl] N-(3-oxopropyl)carbamate |
|---|---|
| PubChem CID | 135300540 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [(2E,5Z)-6-methylocta-2,5-dienyl] N-(3-oxopropyl)carbamate |
| SMILES | CC/C(C)=C\C/C=C/COC(=O)NCCC=O |
| InChI | InChI=1S/C13H21NO3/c1-3-12(2)8-5-4-6-11-17-13(16)14-9-7-10-15/h4,6,8,10H,3,5,7,9,11H2,1-2H3,(H,14,16)/b6-4+,12-8- |
| InChIKey | NUQDFNUMADGOKP-HOGPSILUSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|