About N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine
N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine (PubChem CID 135300546) has the molecular formula C13H23FN2
and a molecular weight of 226.34 g/mol. Its IUPAC name is N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine |
| PubChem CID | 135300546 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine |
| SMILES | CC(C)C1C=C(F)C=C(CNCN(C)C)C1 |
| InChI | InChI=1S/C13H23FN2/c1-10(2)12-5-11(6-13(14)7-12)8-15-9-16(3)4/h6-7,10,12,15H,5,8-9H2,1-4H3 |
| InChIKey | HKAJROYCOCEJMS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine?
The IUPAC name of N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine (CID 135300546) is N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine.
What is the SMILES notation for N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine?
The canonical SMILES for N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine is CC(C)C1C=C(F)C=C(CNCN(C)C)C1.
What is the InChIKey of N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine?
The InChIKey is HKAJROYCOCEJMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23FN2/c1-10(2)12-5-11(6-13(14)7-12)8-15-9-16(3)4/h6-7,10,12,15H,5,8-9H2,1-4H3.
What are the key properties of N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine?
N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine has a molecular weight of 226.34 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluoro-5-propan-2-ylcyclohexa-1,3-dien-1-yl)methyl]-N',N'-dimethylmethanediamine is sourced from PubChem (CID 135300546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).