About cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate
cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate (PubChem CID 135300638) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate.
Molecular Properties
| Compound Name | cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate |
| PubChem CID | 135300638 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate |
| SMILES | CC(C)=C/C=C(\C)COC(=O)N[C@@H](C)C(=O)OCC#N |
| InChI | InChI=1S/C14H20N2O4/c1-10(2)5-6-11(3)9-20-14(18)16-12(4)13(17)19-8-7-15/h5-6,12H,8-9H2,1-4H3,(H,16,18)/b11-6+/t12-/m0/s1 |
| InChIKey | LZODULCAKXTPEM-BCMYLCSRSA-N |
| XLogP | 2.08 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate?
The IUPAC name of cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate (CID 135300638) is cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate.
What is the SMILES notation for cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate?
The canonical SMILES for cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate is CC(C)=C/C=C(\C)COC(=O)N[C@@H](C)C(=O)OCC#N.
What is the InChIKey of cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate?
The InChIKey is LZODULCAKXTPEM-BCMYLCSRSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-10(2)5-6-11(3)9-20-14(18)16-12(4)13(17)19-8-7-15/h5-6,12H,8-9H2,1-4H3,(H,16,18)/b11-6+/t12-/m0/s1.
What are the key properties of cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate?
cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate has a molecular weight of 280.32 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl (2S)-2-[[(2E)-2,5-dimethylhexa-2,4-dienoxy]carbonylamino]propanoate is sourced from PubChem (CID 135300638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).