C41H79N3 — CID 135302591
(5E)-9-N-methyl-9-N-[8-(7-methyloctylamino)non-8-enyl]-2-N-(10-methylundecyl)deca-1,5,9-triene-2,9-diamine (PubChem CID 135302591) has the molecular formula C41H79N3 and a molecular weight of 614.10 g/mol. Its IUPAC name is (5E)-9-N-methyl-9-N-[8-(7-methyloctylamino)non-8-enyl]-2-N-(10-methylundecyl)deca-1,5,9-triene-2,9-diamine.
| Compound Name | (5E)-9-N-methyl-9-N-[8-(7-methyloctylamino)non-8-enyl]-2-N-(10-methylundecyl)deca-1,5,9-triene-2,9-diamine |
|---|---|
| PubChem CID | 135302591 |
| Molecular Formula | C41H79N3 |
| Molecular Weight | 614.10 g/mol |
| Exact Mass | 613.63 |
| IUPAC Name | (5E)-9-N-methyl-9-N-[8-(7-methyloctylamino)non-8-enyl]-2-N-(10-methylundecyl)deca-1,5,9-triene-2,9-diamine |
| SMILES | C=C(CC/C=C/CCC(=C)N(C)CCCCCCCC(=C)NCCCCCCC(C)C)NCCCCCCCCCC(C)C |
| InChI | InChI=1S/C41H79N3/c1-37(2)29-21-13-10-9-11-18-26-34-42-40(6)32-24-15-16-25-33-41(7)44(8)36-28-20-12-14-23-31-39(5)43-35-27-19-17-22-30-38(3)4/h15-16,37-38,42-43H,5-7,9-14,17-36H2,1-4,8H3/b16-15+ |
| InChIKey | LFRGRTDYLHSETL-FOCLMDBBSA-N |
| XLogP | 12.48 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.10 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|