C15H20F3NO4 — CID 135302730
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-3,4,5-triol (PubChem CID 135302730) has the molecular formula C15H20F3NO4 and a molecular weight of 335.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 135302730 |
| Molecular Formula | C15H20F3NO4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-3,4,5-triol |
| SMILES | CC(c1ccc(C(F)(F)F)cc1)N1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C15H20F3NO4/c1-8(9-2-4-10(5-3-9)15(16,17)18)19-6-12(21)14(23)13(22)11(19)7-20/h2-5,8,11-14,20-23H,6-7H2,1H3/t8?,11-,12+,13-,14-/m1/s1 |
| InChIKey | XHOVSBDABLNAEE-SUALPBTHSA-N |
| XLogP | 0.53 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |