C14H23NO4 — CID 135302845
(2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-3,4,5-triol (PubChem CID 135302845) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 135302845 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-3,4,5-triol |
| SMILES | C=C/C=C\C=C(/C)C[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H23NO4/c1-3-4-5-6-9(2)7-10-12(17)14(19)13(18)11(8-16)15-10/h3-6,10-19H,1,7-8H2,2H3/b5-4-,9-6+/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | XDWLTCVMVZJFNY-XNLGYUGJSA-N |
| XLogP | -0.52 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|