C22H39NO5 — CID 135302995
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[4-[(4-methyl-2-bicyclo[4.2.2]dec-5-enyl)methoxy]butyl]piperidine-3,4,5-triol (PubChem CID 135302995) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[4-[(4-methyl-2-bicyclo[4.2.2]dec-5-enyl)methoxy]butyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[4-[(4-methyl-2-bicyclo[4.2.2]dec-5-enyl)methoxy]butyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 135302995 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[4-[(4-methyl-2-bicyclo[4.2.2]dec-5-enyl)methoxy]butyl]piperidine-3,4,5-triol |
| SMILES | CC1C=C2CCC(CC2)C(COCCCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)C1 |
| InChI | InChI=1S/C22H39NO5/c1-15-10-16-4-6-17(7-5-16)18(11-15)14-28-9-3-2-8-23-12-20(25)22(27)21(26)19(23)13-24/h10,15,17-22,24-27H,2-9,11-14H2,1H3/b16-10-/t15?,17?,18?,19-,20+,21-,22-/m1/s1 |
| InChIKey | PXWBCGWWIANEGN-SZSABDJTSA-N |
| XLogP | 1.32 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|