C7H9N3O — CID 135303222
5-buta-1,3-dien-2-yl-3-methoxy-1H-1,2,4-triazole (PubChem CID 135303222) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-3-methoxy-1H-1,2,4-triazole.
| Compound Name | 5-buta-1,3-dien-2-yl-3-methoxy-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 135303222 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-3-methoxy-1H-1,2,4-triazole |
| SMILES | C=CC(=C)c1nc(OC)n[nH]1 |
| InChI | InChI=1S/C7H9N3O/c1-4-5(2)6-8-7(11-3)10-9-6/h4H,1-2H2,3H3,(H,8,9,10) |
| InChIKey | UZJPTDRTEUSHBR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|