About 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine
3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine (PubChem CID 135303675) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine.
Analyze 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine?
The IUPAC name of 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine (CID 135303675) is 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine.
What is the SMILES notation for 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine?
The canonical SMILES for 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine is CC1=CN=C=CC=C1N.
What is the InChIKey of 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine?
The InChIKey is NRHWZBLCRNGDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-6-5-9-4-2-3-7(6)8/h2-3,5H,8H2,1H3.
What are the key properties of 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine?
3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine has a molecular weight of 120.15 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-azacyclohepta-2,4,6,7-tetraen-4-amine is sourced from PubChem (CID 135303675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).