C27H31F3N4O4S — CID 135303706
N-[[4-(8-phenyloctanoyl)morpholin-3-yl]methyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophene-2-carboxamide (PubChem CID 135303706) has the molecular formula C27H31F3N4O4S and a molecular weight of 564.63 g/mol. Its IUPAC name is N-[[4-(8-phenyloctanoyl)morpholin-3-yl]methyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(8-phenyloctanoyl)morpholin-3-yl]methyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135303706 |
| Molecular Formula | C27H31F3N4O4S |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | N-[[4-(8-phenyloctanoyl)morpholin-3-yl]methyl]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NCC1COCCN1C(=O)CCCCCCCc1ccccc1)c1ccc(-c2noc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C27H31F3N4O4S/c28-27(29,30)26-32-24(33-38-26)21-13-14-22(39-21)25(36)31-17-20-18-37-16-15-34(20)23(35)12-8-3-1-2-5-9-19-10-6-4-7-11-19/h4,6-7,10-11,13-14,20H,1-3,5,8-9,12,15-18H2,(H,31,36) |
| InChIKey | VQDSLZFDHGRMGT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|