About 2-chloro-3,5-diiodo-1H-pyridin-4-one
2-chloro-3,5-diiodo-1H-pyridin-4-one (PubChem CID 135303894) has the molecular formula C5H2ClI2NO
and a molecular weight of 381.34 g/mol. Its IUPAC name is 2-chloro-3,5-diiodo-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-chloro-3,5-diiodo-1H-pyridin-4-one |
| PubChem CID | 135303894 |
| Molecular Formula | C5H2ClI2NO |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 380.79 |
| IUPAC Name | 2-chloro-3,5-diiodo-1H-pyridin-4-one |
| SMILES | O=c1c(I)c[nH]c(Cl)c1I |
| InChI | InChI=1S/C5H2ClI2NO/c6-5-3(8)4(10)2(7)1-9-5/h1H,(H,9,10) |
| InChIKey | DPHOWLYOBWCRKU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,5-diiodo-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,5-diiodo-1H-pyridin-4-one?
The IUPAC name of 2-chloro-3,5-diiodo-1H-pyridin-4-one (CID 135303894) is 2-chloro-3,5-diiodo-1H-pyridin-4-one.
What is the SMILES notation for 2-chloro-3,5-diiodo-1H-pyridin-4-one?
The canonical SMILES for 2-chloro-3,5-diiodo-1H-pyridin-4-one is O=c1c(I)c[nH]c(Cl)c1I.
What is the InChIKey of 2-chloro-3,5-diiodo-1H-pyridin-4-one?
The InChIKey is DPHOWLYOBWCRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2ClI2NO/c6-5-3(8)4(10)2(7)1-9-5/h1H,(H,9,10).
What are the key properties of 2-chloro-3,5-diiodo-1H-pyridin-4-one?
2-chloro-3,5-diiodo-1H-pyridin-4-one has a molecular weight of 381.34 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,5-diiodo-1H-pyridin-4-one is sourced from PubChem (CID 135303894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).