About (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol
(2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol (PubChem CID 135304187) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol.
Molecular Properties
| Compound Name | (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol |
| PubChem CID | 135304187 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol |
| SMILES | Cc1cc2ncn(CCC[C@H]3NCCC[C@@H]3O)c2cc1C |
| InChI | InChI=1S/C17H25N3O/c1-12-9-15-16(10-13(12)2)20(11-19-15)8-4-5-14-17(21)6-3-7-18-14/h9-11,14,17-18,21H,3-8H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | IMVWMSOEBOPCPD-PBHICJAKSA-N |
| XLogP | 2.55 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol?
The IUPAC name of (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol (CID 135304187) is (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol.
What is the SMILES notation for (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol?
The canonical SMILES for (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol is Cc1cc2ncn(CCC[C@H]3NCCC[C@@H]3O)c2cc1C.
What is the InChIKey of (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol?
The InChIKey is IMVWMSOEBOPCPD-PBHICJAKSA-N. The full InChI is InChI=1S/C17H25N3O/c1-12-9-15-16(10-13(12)2)20(11-19-15)8-4-5-14-17(21)6-3-7-18-14/h9-11,14,17-18,21H,3-8H2,1-2H3/t14-,17+/m1/s1.
What are the key properties of (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol?
(2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol has a molecular weight of 287.41 g/mol, XLogP of 2.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-[3-(5,6-dimethylbenzimidazol-1-yl)propyl]piperidin-3-ol is sourced from PubChem (CID 135304187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).