About methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate
methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate (PubChem CID 135304295) has the molecular formula C18H21BrN2O3
and a molecular weight of 393.28 g/mol. Its IUPAC name is methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate |
| PubChem CID | 135304295 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(C/C=C/[C@H]2NCCC[C@@H]2O)c2cc(Br)ccc12 |
| InChI | InChI=1S/C18H21BrN2O3/c1-24-18(23)14-11-21(16-10-12(19)6-7-13(14)16)9-3-4-15-17(22)5-2-8-20-15/h3-4,6-7,10-11,15,17,20,22H,2,5,8-9H2,1H3/b4-3+/t15-,17+/m1/s1 |
| InChIKey | ZBLZLJGXQHHUEZ-JUPLKNRCSA-N |
| XLogP | 2.86 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
The IUPAC name of methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate (CID 135304295) is methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate.
What is the SMILES notation for methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
The canonical SMILES for methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate is COC(=O)c1cn(C/C=C/[C@H]2NCCC[C@@H]2O)c2cc(Br)ccc12.
What is the InChIKey of methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
The InChIKey is ZBLZLJGXQHHUEZ-JUPLKNRCSA-N. The full InChI is InChI=1S/C18H21BrN2O3/c1-24-18(23)14-11-21(16-10-12(19)6-7-13(14)16)9-3-4-15-17(22)5-2-8-20-15/h3-4,6-7,10-11,15,17,20,22H,2,5,8-9H2,1H3/b4-3+/t15-,17+/m1/s1.
What are the key properties of methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate has a molecular weight of 393.28 g/mol, XLogP of 2.86, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate is sourced from PubChem (CID 135304295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).