About 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid
2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid (PubChem CID 135304352) has the molecular formula C15H9F3N2O5
and a molecular weight of 354.24 g/mol. Its IUPAC name is 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid |
| PubChem CID | 135304352 |
| Molecular Formula | C15H9F3N2O5 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid |
| SMILES | O=C(O)Cn1c(=O)oc2ccc(-c3ccc(OC(F)(F)F)cc3)nc21 |
| InChI | InChI=1S/C15H9F3N2O5/c16-15(17,18)25-9-3-1-8(2-4-9)10-5-6-11-13(19-10)20(7-12(21)22)14(23)24-11/h1-6H,7H2,(H,21,22) |
| InChIKey | HDFTVPNEAZQMBG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid?
The IUPAC name of 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid (CID 135304352) is 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid.
What is the SMILES notation for 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid?
The canonical SMILES for 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid is O=C(O)Cn1c(=O)oc2ccc(-c3ccc(OC(F)(F)F)cc3)nc21.
What is the InChIKey of 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid?
The InChIKey is HDFTVPNEAZQMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3N2O5/c16-15(17,18)25-9-3-1-8(2-4-9)10-5-6-11-13(19-10)20(7-12(21)22)14(23)24-11/h1-6H,7H2,(H,21,22).
What are the key properties of 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid?
2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid has a molecular weight of 354.24 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-oxo-5-[4-(trifluoromethoxy)phenyl]-[1,3]oxazolo[4,5-b]pyridin-3-yl]acetic acid is sourced from PubChem (CID 135304352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).