C19H18BrNO4 — CID 135304586
(E)-3-[4-bromo-3-[3-(2-methoxyphenyl)propanoylamino]phenyl]prop-2-enoic acid (PubChem CID 135304586) has the molecular formula C19H18BrNO4 and a molecular weight of 404.26 g/mol. Its IUPAC name is (E)-3-[4-bromo-3-[3-(2-methoxyphenyl)propanoylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-bromo-3-[3-(2-methoxyphenyl)propanoylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135304586 |
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (E)-3-[4-bromo-3-[3-(2-methoxyphenyl)propanoylamino]phenyl]prop-2-enoic acid |
| SMILES | COc1ccccc1CCC(=O)Nc1cc(/C=C/C(=O)O)ccc1Br |
| InChI | InChI=1S/C19H18BrNO4/c1-25-17-5-3-2-4-14(17)8-10-18(22)21-16-12-13(6-9-15(16)20)7-11-19(23)24/h2-7,9,11-12H,8,10H2,1H3,(H,21,22)(H,23,24)/b11-7+ |
| InChIKey | WKRJDUYGXZXXOP-YRNVUSSQSA-N |
| XLogP | 4.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|