C24H35N3O4 — CID 135304655
[4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(2-pyrazol-1-ylethyl)azetidine-1-carboxylate (PubChem CID 135304655) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is [4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(2-pyrazol-1-ylethyl)azetidine-1-carboxylate.
| Compound Name | [4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(2-pyrazol-1-ylethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 135304655 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | [4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(2-pyrazol-1-ylethyl)azetidine-1-carboxylate |
| SMILES | CC(C)=CC[C@H]1O[C@]1(C)C1CC(OC(=O)N2CC(CCn3cccn3)C2)CCC12CO2 |
| InChI | InChI=1S/C24H35N3O4/c1-17(2)5-6-21-23(3,31-21)20-13-19(7-9-24(20)16-29-24)30-22(28)26-14-18(15-26)8-12-27-11-4-10-25-27/h4-5,10-11,18-21H,6-9,12-16H2,1-3H3/t19?,20?,21-,23-,24?/m1/s1 |
| InChIKey | DEUYILYBGYZOJH-FTYXSHOASA-N |
| XLogP | 3.79 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|