C21H18F3N5O2 — CID 135304664
2-prop-2-enoxy-N-[6-(4-prop-2-enyl-1,2,4-triazol-3-yl)-2-pyridinyl]-4-(trifluoromethyl)benzamide (PubChem CID 135304664) has the molecular formula C21H18F3N5O2 and a molecular weight of 429.40 g/mol. Its IUPAC name is 2-prop-2-enoxy-N-[6-(4-prop-2-enyl-1,2,4-triazol-3-yl)-2-pyridinyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-prop-2-enoxy-N-[6-(4-prop-2-enyl-1,2,4-triazol-3-yl)-2-pyridinyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135304664 |
| Molecular Formula | C21H18F3N5O2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-prop-2-enoxy-N-[6-(4-prop-2-enyl-1,2,4-triazol-3-yl)-2-pyridinyl]-4-(trifluoromethyl)benzamide |
| SMILES | C=CCOc1cc(C(F)(F)F)ccc1C(=O)Nc1cccc(-c2nncn2CC=C)n1 |
| InChI | InChI=1S/C21H18F3N5O2/c1-3-10-29-13-25-28-19(29)16-6-5-7-18(26-16)27-20(30)15-9-8-14(21(22,23)24)12-17(15)31-11-4-2/h3-9,12-13H,1-2,10-11H2,(H,26,27,30) |
| InChIKey | LYUIGDKLPMNTHH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|