C23H24F3N5O2 — CID 135304871
N-[6-(4-pentyl-1,2,4-triazol-3-yl)-2-pyridinyl]-2-prop-2-enoxy-4-(trifluoromethyl)benzamide (PubChem CID 135304871) has the molecular formula C23H24F3N5O2 and a molecular weight of 459.47 g/mol. Its IUPAC name is N-[6-(4-pentyl-1,2,4-triazol-3-yl)-2-pyridinyl]-2-prop-2-enoxy-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-(4-pentyl-1,2,4-triazol-3-yl)-2-pyridinyl]-2-prop-2-enoxy-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135304871 |
| Molecular Formula | C23H24F3N5O2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[6-(4-pentyl-1,2,4-triazol-3-yl)-2-pyridinyl]-2-prop-2-enoxy-4-(trifluoromethyl)benzamide |
| SMILES | C=CCOc1cc(C(F)(F)F)ccc1C(=O)Nc1cccc(-c2nncn2CCCCC)n1 |
| InChI | InChI=1S/C23H24F3N5O2/c1-3-5-6-12-31-15-27-30-21(31)18-8-7-9-20(28-18)29-22(32)17-11-10-16(23(24,25)26)14-19(17)33-13-4-2/h4,7-11,14-15H,2-3,5-6,12-13H2,1H3,(H,28,29,32) |
| InChIKey | UMDRGOBVJNYVSA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|