About 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile
2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile (PubChem CID 135305016) has the molecular formula C12H8F4N2O
and a molecular weight of 272.20 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile |
| PubChem CID | 135305016 |
| Molecular Formula | C12H8F4N2O |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(F)c1C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C12H8F4N2O/c13-8-3-7(5-17)10(9(14)4-8)11(19)18-2-1-12(15,16)6-18/h3-4H,1-2,6H2 |
| InChIKey | BKUBAUZIGIMMHT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile?
The IUPAC name of 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile (CID 135305016) is 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile.
What is the SMILES notation for 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile?
The canonical SMILES for 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile is N#Cc1cc(F)cc(F)c1C(=O)N1CCC(F)(F)C1.
What is the InChIKey of 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile?
The InChIKey is BKUBAUZIGIMMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F4N2O/c13-8-3-7(5-17)10(9(14)4-8)11(19)18-2-1-12(15,16)6-18/h3-4H,1-2,6H2.
What are the key properties of 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile?
2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile has a molecular weight of 272.20 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropyrrolidine-1-carbonyl)-3,5-difluorobenzonitrile is sourced from PubChem (CID 135305016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).