C28H27F11O3S — CID 135305505
3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]sulfanyl]octan-1-ol (PubChem CID 135305505) has the molecular formula C28H27F11O3S and a molecular weight of 652.57 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]sulfanyl]octan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]sulfanyl]octan-1-ol |
|---|---|
| PubChem CID | 135305505 |
| Molecular Formula | C28H27F11O3S |
| Molecular Weight | 652.57 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]sulfanyl]octan-1-ol |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO)cc3o2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C28H27F11O3S/c1-2-3-4-5-17-6-9-20(23(14-17)42-28(37,38)39)22-15-18-7-8-19(16-21(18)41-22)43-13-11-25(31,32)27(35,36)26(33,34)24(29,30)10-12-40/h6-9,14-16,40H,2-5,10-13H2,1H3 |
| InChIKey | KRRZGDVYMTWLCG-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.57 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|