About (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione
(3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione (PubChem CID 135305792) has the molecular formula C20H19NO3
and a molecular weight of 321.38 g/mol. Its IUPAC name is (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione.
Molecular Properties
| Compound Name | (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione |
| PubChem CID | 135305792 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione |
| SMILES | O=C1CCO[C@@]2(C1)C(=O)N(CCc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C20H19NO3/c22-16-11-13-24-20(14-16)17-8-4-5-9-18(17)21(19(20)23)12-10-15-6-2-1-3-7-15/h1-9H,10-14H2/t20-/m1/s1 |
| InChIKey | DBKWJYBWWYKIBP-HXUWFJFHSA-N |
| XLogP | 2.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione?
The IUPAC name of (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione (CID 135305792) is (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione.
What is the SMILES notation for (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione?
The canonical SMILES for (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione is O=C1CCO[C@@]2(C1)C(=O)N(CCc1ccccc1)c1ccccc12.
What is the InChIKey of (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione?
The InChIKey is DBKWJYBWWYKIBP-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H19NO3/c22-16-11-13-24-20(14-16)17-8-4-5-9-18(17)21(19(20)23)12-10-15-6-2-1-3-7-15/h1-9H,10-14H2/t20-/m1/s1.
What are the key properties of (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione?
(3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione has a molecular weight of 321.38 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2-phenylethyl)spiro[indole-3,2'-oxane]-2,4'-dione is sourced from PubChem (CID 135305792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).