About 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine
5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine (PubChem CID 135306123) has the molecular formula C10H15F3N4
and a molecular weight of 248.25 g/mol. Its IUPAC name is 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine |
| PubChem CID | 135306123 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine |
| SMILES | Nc1cc(C2CCN(CC(F)(F)F)CC2)[nH]n1 |
| InChI | InChI=1S/C10H15F3N4/c11-10(12,13)6-17-3-1-7(2-4-17)8-5-9(14)16-15-8/h5,7H,1-4,6H2,(H3,14,15,16) |
| InChIKey | SJBBASQDXCSMPY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine?
The IUPAC name of 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine (CID 135306123) is 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine.
What is the SMILES notation for 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine?
The canonical SMILES for 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine is Nc1cc(C2CCN(CC(F)(F)F)CC2)[nH]n1.
What is the InChIKey of 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine?
The InChIKey is SJBBASQDXCSMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N4/c11-10(12,13)6-17-3-1-7(2-4-17)8-5-9(14)16-15-8/h5,7H,1-4,6H2,(H3,14,15,16).
What are the key properties of 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine?
5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine has a molecular weight of 248.25 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-pyrazol-3-amine is sourced from PubChem (CID 135306123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).