About 1-butylsulfinylbutane;2-methylpropanamide
1-butylsulfinylbutane;2-methylpropanamide (PubChem CID 135307330) has the molecular formula C12H27NO2S
and a molecular weight of 249.42 g/mol. Its IUPAC name is 1-butylsulfinylbutane;2-methylpropanamide.
Molecular Properties
| Compound Name | 1-butylsulfinylbutane;2-methylpropanamide |
| PubChem CID | 135307330 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-butylsulfinylbutane;2-methylpropanamide |
| SMILES | CC(C)C(N)=O.CCCCS(=O)CCCC |
| InChI | InChI=1S/C8H18OS.C4H9NO/c1-3-5-7-10(9)8-6-4-2;1-3(2)4(5)6/h3-8H2,1-2H3;3H,1-2H3,(H2,5,6) |
| InChIKey | RYLJNFXGTHBDMY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butylsulfinylbutane;2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfinylbutane;2-methylpropanamide?
The IUPAC name of 1-butylsulfinylbutane;2-methylpropanamide (CID 135307330) is 1-butylsulfinylbutane;2-methylpropanamide.
What is the SMILES notation for 1-butylsulfinylbutane;2-methylpropanamide?
The canonical SMILES for 1-butylsulfinylbutane;2-methylpropanamide is CC(C)C(N)=O.CCCCS(=O)CCCC.
What is the InChIKey of 1-butylsulfinylbutane;2-methylpropanamide?
The InChIKey is RYLJNFXGTHBDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18OS.C4H9NO/c1-3-5-7-10(9)8-6-4-2;1-3(2)4(5)6/h3-8H2,1-2H3;3H,1-2H3,(H2,5,6).
What are the key properties of 1-butylsulfinylbutane;2-methylpropanamide?
1-butylsulfinylbutane;2-methylpropanamide has a molecular weight of 249.42 g/mol, XLogP of 2.46, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfinylbutane;2-methylpropanamide is sourced from PubChem (CID 135307330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).