C31H25Cl2N3O5 — CID 135307410
[[(2S,3S,4R,5R)-5-(4-chloro-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate (PubChem CID 135307410) has the molecular formula C31H25Cl2N3O5 and a molecular weight of 590.46 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(4-chloro-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate.
| Compound Name | [[(2S,3S,4R,5R)-5-(4-chloro-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307410 |
| Molecular Formula | C31H25Cl2N3O5 |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(4-chloro-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
| SMILES | Cc1nc(Cl)c2ccn([C@@H]3O[C@H](C(OC(=O)c4ccc(-c5ccccc5)cc4)c4ccc(Cl)cc4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C31H25Cl2N3O5/c1-17-34-28(33)23-15-16-36(29(23)35-17)30-25(38)24(37)27(40-30)26(20-11-13-22(32)14-12-20)41-31(39)21-9-7-19(8-10-21)18-5-3-2-4-6-18/h2-16,24-27,30,37-38H,1H3/t24-,25+,26?,27-,30+/m0/s1 |
| InChIKey | INBVAFFZLNVLSN-PUBPHQORSA-N |
| XLogP | 5.93 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |