C30H23Cl2N3O5 — CID 135307444
[(R)-(4-chlorophenyl)-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate (PubChem CID 135307444) has the molecular formula C30H23Cl2N3O5 and a molecular weight of 576.44 g/mol. Its IUPAC name is [(R)-(4-chlorophenyl)-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate.
| Compound Name | [(R)-(4-chlorophenyl)-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307444 |
| Molecular Formula | C30H23Cl2N3O5 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | [(R)-(4-chlorophenyl)-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-phenylbenzoate |
| SMILES | O=C(O[C@H](c1ccc(Cl)cc1)[C@H]1O[C@@H](n2ccc3c(Cl)ncnc32)[C@H](O)[C@@H]1O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H23Cl2N3O5/c31-21-12-10-19(11-13-21)25(40-30(38)20-8-6-18(7-9-20)17-4-2-1-3-5-17)26-23(36)24(37)29(39-26)35-15-14-22-27(32)33-16-34-28(22)35/h1-16,23-26,29,36-37H/t23-,24+,25+,26-,29+/m0/s1 |
| InChIKey | NTONVCZRMQEMPM-MQYJMQNVSA-N |
| XLogP | 5.62 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |