C33H30Cl2N4O7 — CID 135307466
[(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[5-(2-hydroxyethyl)-4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate (PubChem CID 135307466) has the molecular formula C33H30Cl2N4O7 and a molecular weight of 665.53 g/mol. Its IUPAC name is [(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[5-(2-hydroxyethyl)-4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate.
| Compound Name | [(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[5-(2-hydroxyethyl)-4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307466 |
| Molecular Formula | C33H30Cl2N4O7 |
| Molecular Weight | 665.53 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | [(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[5-(2-hydroxyethyl)-4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate |
| SMILES | CONc1ncnc2c1c(CCO)cn2[C@@H]1O[C@H](C(OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(Cl)c(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C33H30Cl2N4O7/c1-44-38-30-25-22(13-14-40)16-39(31(25)37-17-36-30)32-27(42)26(41)29(45-32)28(21-11-12-23(34)24(35)15-21)46-33(43)20-9-7-19(8-10-20)18-5-3-2-4-6-18/h2-12,15-17,26-29,32,40-42H,13-14H2,1H3,(H,36,37,38)/t26-,27+,28?,29-,32+/m0/s1 |
| InChIKey | ISRKKBTZSUHICV-NDMWOBELSA-N |
| XLogP | 5.13 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|