C31H26Cl2N4O6 — CID 135307485
[(R)-(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate (PubChem CID 135307485) has the molecular formula C31H26Cl2N4O6 and a molecular weight of 621.48 g/mol. Its IUPAC name is [(R)-(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate.
| Compound Name | [(R)-(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307485 |
| Molecular Formula | C31H26Cl2N4O6 |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | [(R)-(3,4-dichlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl] 4-phenylbenzoate |
| SMILES | CONc1ncnc2c1ccn2[C@@H]1O[C@H]([C@H](OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(Cl)c(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C31H26Cl2N4O6/c1-41-36-28-21-13-14-37(29(21)35-16-34-28)30-25(39)24(38)27(42-30)26(20-11-12-22(32)23(33)15-20)43-31(40)19-9-7-18(8-10-19)17-5-3-2-4-6-17/h2-16,24-27,30,38-39H,1H3,(H,34,35,36)/t24-,25+,26+,27-,30+/m0/s1 |
| InChIKey | KELFJLRRXXXVNX-JQZLSKBLSA-N |
| XLogP | 5.60 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|