C32H29ClN4O5 — CID 135307517
[(4-chlorophenyl)-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl] 4-phenylbenzoate (PubChem CID 135307517) has the molecular formula C32H29ClN4O5 and a molecular weight of 585.06 g/mol. Its IUPAC name is [(4-chlorophenyl)-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl] 4-phenylbenzoate.
| Compound Name | [(4-chlorophenyl)-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307517 |
| Molecular Formula | C32H29ClN4O5 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | [(4-chlorophenyl)-[(1S,2R,3S,4R)-2,3-dihydroxy-4-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methyl] 4-phenylbenzoate |
| SMILES | CONc1ncnc2c1ccn2[C@@H]1C[C@H](C(OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C32H29ClN4O5/c1-41-36-30-24-15-16-37(31(24)35-18-34-30)26-17-25(27(38)28(26)39)29(21-11-13-23(33)14-12-21)42-32(40)22-9-7-20(8-10-22)19-5-3-2-4-6-19/h2-16,18,25-29,38-39H,17H2,1H3,(H,34,35,36)/t25-,26+,27+,28-,29?/m0/s1 |
| InChIKey | MOLGGBFBDBSOQJ-VOTWOKPGSA-N |
| XLogP | 5.61 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|