C17H21F3O5 — CID 135307561
(S)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methanol (PubChem CID 135307561) has the molecular formula C17H21F3O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is (S)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | (S)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 135307561 |
| Molecular Formula | C17H21F3O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (S)-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-[3-methyl-4-(trifluoromethyl)phenyl]methanol |
| SMILES | CO[C@@H]1O[C@H]([C@@H](O)c2ccc(C(F)(F)F)c(C)c2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H21F3O5/c1-8-7-9(5-6-10(8)17(18,19)20)11(21)12-13-14(15(22-4)23-12)25-16(2,3)24-13/h5-7,11-15,21H,1-4H3/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | YLAMRPQHCCOHTI-NJVJYBDUSA-N |
| XLogP | 2.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |