About 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride
5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride (PubChem CID 135307680) has the molecular formula C6H12ClN3S
and a molecular weight of 193.70 g/mol. Its IUPAC name is 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride |
| PubChem CID | 135307680 |
| Molecular Formula | C6H12ClN3S |
| Molecular Weight | 193.70 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride |
| SMILES | CCCCc1nnc(N)s1.Cl |
| InChI | InChI=1S/C6H11N3S.ClH/c1-2-3-4-5-8-9-6(7)10-5;/h2-4H2,1H3,(H2,7,9);1H |
| InChIKey | RUYRKSFOYQXDQL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride?
The IUPAC name of 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride (CID 135307680) is 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride?
The canonical SMILES for 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride is CCCCc1nnc(N)s1.Cl.
What is the InChIKey of 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride?
The InChIKey is RUYRKSFOYQXDQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3S.ClH/c1-2-3-4-5-8-9-6(7)10-5;/h2-4H2,1H3,(H2,7,9);1H.
What are the key properties of 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride?
5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride has a molecular weight of 193.70 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-1,3,4-thiadiazol-2-amine;hydrochloride is sourced from PubChem (CID 135307680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).