About (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride
(3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride (PubChem CID 135307753) has the molecular formula C8H13ClN2O2
and a molecular weight of 204.66 g/mol. Its IUPAC name is (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride |
| PubChem CID | 135307753 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CC[C@@H](c2cnco2)OC1 |
| InChI | InChI=1S/C8H12N2O2.ClH/c9-6-1-2-7(11-4-6)8-3-10-5-12-8;/h3,5-7H,1-2,4,9H2;1H/t6-,7+;/m1./s1 |
| InChIKey | RKTZDJYSJQNSEA-HHQFNNIRSA-N |
| XLogP | 1.28 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride?
The IUPAC name of (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride (CID 135307753) is (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride.
What is the SMILES notation for (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride?
The canonical SMILES for (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride is Cl.N[C@@H]1CC[C@@H](c2cnco2)OC1.
What is the InChIKey of (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride?
The InChIKey is RKTZDJYSJQNSEA-HHQFNNIRSA-N. The full InChI is InChI=1S/C8H12N2O2.ClH/c9-6-1-2-7(11-4-6)8-3-10-5-12-8;/h3,5-7H,1-2,4,9H2;1H/t6-,7+;/m1./s1.
What are the key properties of (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride?
(3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride has a molecular weight of 204.66 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-amine;hydrochloride is sourced from PubChem (CID 135307753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).