C21H22ClFN4O2S — CID 135307868
4-[(4-benzyl-1,3-thiazol-2-yl)amino]-6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide (PubChem CID 135307868) has the molecular formula C21H22ClFN4O2S and a molecular weight of 448.95 g/mol. Its IUPAC name is 4-[(4-benzyl-1,3-thiazol-2-yl)amino]-6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide.
| Compound Name | 4-[(4-benzyl-1,3-thiazol-2-yl)amino]-6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135307868 |
| Molecular Formula | C21H22ClFN4O2S |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 4-[(4-benzyl-1,3-thiazol-2-yl)amino]-6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide |
| SMILES | CC(C)(O)C(F)CNC(=O)c1cnc(Cl)cc1Nc1nc(Cc2ccccc2)cs1 |
| InChI | InChI=1S/C21H22ClFN4O2S/c1-21(2,29)17(23)11-25-19(28)15-10-24-18(22)9-16(15)27-20-26-14(12-30-20)8-13-6-4-3-5-7-13/h3-7,9-10,12,17,29H,8,11H2,1-2H3,(H,25,28)(H,24,26,27) |
| InChIKey | ZKINBNWIVDUBPB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|