About N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide
N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide (PubChem CID 135308391) has the molecular formula C8H11N3O2S
and a molecular weight of 213.26 g/mol. Its IUPAC name is N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide.
Molecular Properties
| Compound Name | N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide |
| PubChem CID | 135308391 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide |
| SMILES | O=CNc1nc(C2COCCN2)cs1 |
| InChI | InChI=1S/C8H11N3O2S/c12-5-10-8-11-7(4-14-8)6-3-13-2-1-9-6/h4-6,9H,1-3H2,(H,10,11,12) |
| InChIKey | UNUOGVFARKEMHN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide?
The IUPAC name of N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide (CID 135308391) is N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide.
What is the SMILES notation for N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide?
The canonical SMILES for N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide is O=CNc1nc(C2COCCN2)cs1.
What is the InChIKey of N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide?
The InChIKey is UNUOGVFARKEMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2S/c12-5-10-8-11-7(4-14-8)6-3-13-2-1-9-6/h4-6,9H,1-3H2,(H,10,11,12).
What are the key properties of N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide?
N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide has a molecular weight of 213.26 g/mol, XLogP of 0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-morpholin-3-yl-1,3-thiazol-2-yl)formamide is sourced from PubChem (CID 135308391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).