C18H19N5O3 — CID 135308562
methyl 6-[4-(dimethylamino)phenyl]-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxylate (PubChem CID 135308562) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is methyl 6-[4-(dimethylamino)phenyl]-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxylate.
| Compound Name | methyl 6-[4-(dimethylamino)phenyl]-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxylate |
|---|---|
| PubChem CID | 135308562 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | methyl 6-[4-(dimethylamino)phenyl]-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(N(C)C)cc2)nn(-c2cnn(C)c2)c1=O |
| InChI | InChI=1S/C18H19N5O3/c1-21(2)13-7-5-12(6-8-13)16-9-15(18(25)26-4)17(24)23(20-16)14-10-19-22(3)11-14/h5-11H,1-4H3 |
| InChIKey | ZXWAWWDZPHBGLG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |